C24H17ClN6O8S2 — CID 88944976
1-amino-4-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 88944976) has the molecular formula C24H17ClN6O8S2 and a molecular weight of 617.02 g/mol. Its IUPAC name is 1-amino-4-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 88944976 |
| Molecular Formula | C24H17ClN6O8S2 |
| Molecular Weight | 617.02 g/mol |
| Exact Mass | 616.02 |
| IUPAC Name | 1-amino-4-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Cc1nc(Cl)nc(Nc2ccc(Nc3cc(S(=O)(=O)O)c(N)c4c3C(=O)c3ccccc3C4=O)c(S(=O)(=O)O)c2)n1 |
| InChI | InChI=1S/C24H17ClN6O8S2/c1-10-27-23(25)31-24(28-10)29-11-6-7-14(16(8-11)40(34,35)36)30-15-9-17(41(37,38)39)20(26)19-18(15)21(32)12-4-2-3-5-13(12)22(19)33/h2-9,30H,26H2,1H3,(H,34,35,36)(H,37,38,39)(H,27,28,29,31) |
| InChIKey | HZJAMOQYYBXYEZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 231.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.02 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|