C29H20ClN7O8S2 — CID 123823277
2-[(4-amino-9,10-dioxoanthracen-1-yl)amino]-5-[[4-chloro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 123823277) has the molecular formula C29H20ClN7O8S2 and a molecular weight of 694.11 g/mol. Its IUPAC name is 2-[(4-amino-9,10-dioxoanthracen-1-yl)amino]-5-[[4-chloro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-[(4-amino-9,10-dioxoanthracen-1-yl)amino]-5-[[4-chloro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 123823277 |
| Molecular Formula | C29H20ClN7O8S2 |
| Molecular Weight | 694.11 g/mol |
| Exact Mass | 693.05 |
| IUPAC Name | 2-[(4-amino-9,10-dioxoanthracen-1-yl)amino]-5-[[4-chloro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | Nc1ccc(Nc2ccc(Nc3nc(Cl)nc(Nc4ccccc4S(=O)(=O)O)n3)cc2S(=O)(=O)O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H20ClN7O8S2/c30-27-35-28(37-29(36-27)34-18-7-3-4-8-21(18)46(40,41)42)32-14-9-11-19(22(13-14)47(43,44)45)33-20-12-10-17(31)23-24(20)26(39)16-6-2-1-5-15(16)25(23)38/h1-13,33H,31H2,(H,40,41,42)(H,43,44,45)(H2,32,34,35,36,37) |
| InChIKey | DYPVYRZXCCZCFN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 243.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.11 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|