C27H20N2O8S2 — CID 121242115
2-[[9,10-dioxo-4-(2-sulfoanilino)anthracen-1-yl]amino]-5-methylbenzenesulfonic acid (PubChem CID 121242115) has the molecular formula C27H20N2O8S2 and a molecular weight of 564.60 g/mol. Its IUPAC name is 2-[[9,10-dioxo-4-(2-sulfoanilino)anthracen-1-yl]amino]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[[9,10-dioxo-4-(2-sulfoanilino)anthracen-1-yl]amino]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 121242115 |
| Molecular Formula | C27H20N2O8S2 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 2-[[9,10-dioxo-4-(2-sulfoanilino)anthracen-1-yl]amino]-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(Nc2ccc(Nc3ccccc3S(=O)(=O)O)c3c2C(=O)c2ccccc2C3=O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C27H20N2O8S2/c1-15-10-11-19(23(14-15)39(35,36)37)29-21-13-12-20(28-18-8-4-5-9-22(18)38(32,33)34)24-25(21)27(31)17-7-3-2-6-16(17)26(24)30/h2-14,28-29H,1H3,(H,32,33,34)(H,35,36,37) |
| InChIKey | IKOKZDQMLNKUGQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|