C38H42N2O8S2 — CID 59079121
5-hexyl-2-[[4-(4-hexyl-2-sulfoanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonic acid (PubChem CID 59079121) has the molecular formula C38H42N2O8S2 and a molecular weight of 718.89 g/mol. Its IUPAC name is 5-hexyl-2-[[4-(4-hexyl-2-sulfoanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonic acid.
| Compound Name | 5-hexyl-2-[[4-(4-hexyl-2-sulfoanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 59079121 |
| Molecular Formula | C38H42N2O8S2 |
| Molecular Weight | 718.89 g/mol |
| Exact Mass | 718.24 |
| IUPAC Name | 5-hexyl-2-[[4-(4-hexyl-2-sulfoanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonic acid |
| SMILES | CCCCCCc1ccc(Nc2ccc(Nc3ccc(CCCCCC)cc3S(=O)(=O)O)c3c2C(=O)c2ccccc2C3=O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C38H42N2O8S2/c1-3-5-7-9-13-25-17-19-29(33(23-25)49(43,44)45)39-31-21-22-32(36-35(31)37(41)27-15-11-12-16-28(27)38(36)42)40-30-20-18-26(14-10-8-6-4-2)24-34(30)50(46,47)48/h11-12,15-24,39-40H,3-10,13-14H2,1-2H3,(H,43,44,45)(H,46,47,48) |
| InChIKey | WWZHWICZOGLMEG-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.89 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|