C36H58O8S2 — CID 91030401
5-nonyl-2-[6-(4-nonyl-2-sulfophenoxy)hexoxy]benzenesulfonic acid (PubChem CID 91030401) has the molecular formula C36H58O8S2 and a molecular weight of 682.99 g/mol. Its IUPAC name is 5-nonyl-2-[6-(4-nonyl-2-sulfophenoxy)hexoxy]benzenesulfonic acid.
| Compound Name | 5-nonyl-2-[6-(4-nonyl-2-sulfophenoxy)hexoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 91030401 |
| Molecular Formula | C36H58O8S2 |
| Molecular Weight | 682.99 g/mol |
| Exact Mass | 682.36 |
| IUPAC Name | 5-nonyl-2-[6-(4-nonyl-2-sulfophenoxy)hexoxy]benzenesulfonic acid |
| SMILES | CCCCCCCCCc1ccc(OCCCCCCOc2ccc(CCCCCCCCC)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C36H58O8S2/c1-3-5-7-9-11-13-17-21-31-23-25-33(35(29-31)45(37,38)39)43-27-19-15-16-20-28-44-34-26-24-32(30-36(34)46(40,41)42)22-18-14-12-10-8-6-4-2/h23-26,29-30H,3-22,27-28H2,1-2H3,(H,37,38,39)(H,40,41,42) |
| InChIKey | BVAMQPIQQBRNSO-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.99 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|