C20H34O4S — CID 101315249
4-(2,4-dipentylphenoxy)butane-1-sulfonic acid (PubChem CID 101315249) has the molecular formula C20H34O4S and a molecular weight of 370.56 g/mol. Its IUPAC name is 4-(2,4-dipentylphenoxy)butane-1-sulfonic acid.
| Compound Name | 4-(2,4-dipentylphenoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 101315249 |
| Molecular Formula | C20H34O4S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 4-(2,4-dipentylphenoxy)butane-1-sulfonic acid |
| SMILES | CCCCCc1ccc(OCCCCS(=O)(=O)O)c(CCCCC)c1 |
| InChI | InChI=1S/C20H34O4S/c1-3-5-7-11-18-13-14-20(19(17-18)12-8-6-4-2)24-15-9-10-16-25(21,22)23/h13-14,17H,3-12,15-16H2,1-2H3,(H,21,22,23) |
| InChIKey | IUYNWEOJNCNWKH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|