C26H46O4S — CID 101315717
4-(2,4-dioctylphenoxy)butane-1-sulfonic acid (PubChem CID 101315717) has the molecular formula C26H46O4S and a molecular weight of 454.72 g/mol. Its IUPAC name is 4-(2,4-dioctylphenoxy)butane-1-sulfonic acid.
| Compound Name | 4-(2,4-dioctylphenoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 101315717 |
| Molecular Formula | C26H46O4S |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 4-(2,4-dioctylphenoxy)butane-1-sulfonic acid |
| SMILES | CCCCCCCCc1ccc(OCCCCS(=O)(=O)O)c(CCCCCCCC)c1 |
| InChI | InChI=1S/C26H46O4S/c1-3-5-7-9-11-13-17-24-19-20-26(30-21-15-16-22-31(27,28)29)25(23-24)18-14-12-10-8-6-4-2/h19-20,23H,3-18,21-22H2,1-2H3,(H,27,28,29) |
| InChIKey | VRJDQYKDKPFBRD-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|