C22H38O4S — CID 101315413
4-(3,5-dihexylphenoxy)butane-1-sulfonic acid (PubChem CID 101315413) has the molecular formula C22H38O4S and a molecular weight of 398.61 g/mol. Its IUPAC name is 4-(3,5-dihexylphenoxy)butane-1-sulfonic acid.
| Compound Name | 4-(3,5-dihexylphenoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 101315413 |
| Molecular Formula | C22H38O4S |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 4-(3,5-dihexylphenoxy)butane-1-sulfonic acid |
| SMILES | CCCCCCc1cc(CCCCCC)cc(OCCCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C22H38O4S/c1-3-5-7-9-13-20-17-21(14-10-8-6-4-2)19-22(18-20)26-15-11-12-16-27(23,24)25/h17-19H,3-16H2,1-2H3,(H,23,24,25) |
| InChIKey | JBNJGCJUQWVZHQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|