C17H28O5S — CID 58983762
4-(4-heptoxyphenoxy)butane-1-sulfonic acid (PubChem CID 58983762) has the molecular formula C17H28O5S and a molecular weight of 344.47 g/mol. Its IUPAC name is 4-(4-heptoxyphenoxy)butane-1-sulfonic acid.
| Compound Name | 4-(4-heptoxyphenoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983762 |
| Molecular Formula | C17H28O5S |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 4-(4-heptoxyphenoxy)butane-1-sulfonic acid |
| SMILES | CCCCCCCOc1ccc(OCCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H28O5S/c1-2-3-4-5-6-13-21-16-9-11-17(12-10-16)22-14-7-8-15-23(18,19)20/h9-12H,2-8,13-15H2,1H3,(H,18,19,20) |
| InChIKey | ZBZXRNKLCWFNBO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|