but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid

C16H26O4S — CID 142364186

IUPACbut-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid
SMILESC=CCC.Cc1ccc(OCCCCCS(=O)(=O)O)cc1
InChIInChI=1S/C12H18O4S.C4H8/c1-11-5-7-12(8-6-11)16-9-3-2-4-10-17(13,14)15;1-3-4-2/h5-8H,2-4,9-10H2,1H3,(H,13,14,15);3H,1,4H2,2H3
InChIKeyRSGBSQYDKJVWAV-UHFFFAOYSA-N
MW314.45 g/mol
LogP4.01
Rot. Bonds8

About but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid

but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid (PubChem CID 142364186) has the molecular formula C16H26O4S and a molecular weight of 314.45 g/mol. Its IUPAC name is but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid.

Molecular Properties

Compound Namebut-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid
PubChem CID142364186
Molecular FormulaC16H26O4S
Molecular Weight314.45 g/mol
Exact Mass314.16
IUPAC Namebut-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid
SMILESC=CCC.Cc1ccc(OCCCCCS(=O)(=O)O)cc1
InChIInChI=1S/C12H18O4S.C4H8/c1-11-5-7-12(8-6-11)16-9-3-2-4-10-17(13,14)15;1-3-4-2/h5-8H,2-4,9-10H2,1H3,(H,13,14,15);3H,1,4H2,2H3
InChIKeyRSGBSQYDKJVWAV-UHFFFAOYSA-N
XLogP4.01
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.45
LogP ≤ 54.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid?
The IUPAC name of but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid (CID 142364186) is but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid.
What is the SMILES notation for but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid?
The canonical SMILES for but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid is C=CCC.Cc1ccc(OCCCCCS(=O)(=O)O)cc1.
What is the InChIKey of but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid?
The InChIKey is RSGBSQYDKJVWAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4S.C4H8/c1-11-5-7-12(8-6-11)16-9-3-2-4-10-17(13,14)15;1-3-4-2/h5-8H,2-4,9-10H2,1H3,(H,13,14,15);3H,1,4H2,2H3.
What are the key properties of but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid?
but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid has a molecular weight of 314.45 g/mol, XLogP of 4.01, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;5-(4-methylphenoxy)pentane-1-sulfonic acid is sourced from PubChem (CID 142364186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).