C11H17NaO5S — CID 173443474
sodium;hydride;4-(4-methoxyphenoxy)butane-1-sulfonic acid (PubChem CID 173443474) has the molecular formula C11H17NaO5S and a molecular weight of 284.31 g/mol. Its IUPAC name is sodium;hydride;4-(4-methoxyphenoxy)butane-1-sulfonic acid.
| Compound Name | sodium;hydride;4-(4-methoxyphenoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 173443474 |
| Molecular Formula | C11H17NaO5S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | sodium;hydride;4-(4-methoxyphenoxy)butane-1-sulfonic acid |
| SMILES | COc1ccc(OCCCCS(=O)(=O)O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C11H16O5S.Na.H/c1-15-10-4-6-11(7-5-10)16-8-2-3-9-17(12,13)14;;/h4-7H,2-3,8-9H2,1H3,(H,12,13,14);;/q;+1;-1 |
| InChIKey | PGYZSJZHDWMMJQ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|