C12H18O5S — CID 88727030
3-[2-(4-methoxyphenyl)ethoxy]propane-1-sulfonic acid (PubChem CID 88727030) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-(4-methoxyphenyl)ethoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88727030 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethoxy]propane-1-sulfonic acid |
| SMILES | COc1ccc(CCOCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H18O5S/c1-16-12-5-3-11(4-6-12)7-9-17-8-2-10-18(13,14)15/h3-6H,2,7-10H2,1H3,(H,13,14,15) |
| InChIKey | FVKBQBGQMKOCCZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|