C14H23NaO4S — CID 173132600
sodium;hydride;4-(4-phenylbutoxy)butane-1-sulfonic acid (PubChem CID 173132600) has the molecular formula C14H23NaO4S and a molecular weight of 310.39 g/mol. Its IUPAC name is sodium;hydride;4-(4-phenylbutoxy)butane-1-sulfonic acid.
| Compound Name | sodium;hydride;4-(4-phenylbutoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 173132600 |
| Molecular Formula | C14H23NaO4S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | sodium;hydride;4-(4-phenylbutoxy)butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCOCCCCc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C14H22O4S.Na.H/c15-19(16,17)13-7-6-12-18-11-5-4-10-14-8-2-1-3-9-14;;/h1-3,8-9H,4-7,10-13H2,(H,15,16,17);;/q;+1;-1 |
| InChIKey | SBBHIWICMMEVHK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|