C34H56O16S2 — CID 139335910
4-[2-[2-[2-[2-[3-[2-[2-[2-[2-(4-sulfobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]butane-1-sulfonic acid (PubChem CID 139335910) has the molecular formula C34H56O16S2 and a molecular weight of 784.94 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[3-[2-[2-[2-[2-(4-sulfobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]butane-1-sulfonic acid.
| Compound Name | 4-[2-[2-[2-[2-[3-[2-[2-[2-[2-(4-sulfobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 139335910 |
| Molecular Formula | C34H56O16S2 |
| Molecular Weight | 784.94 g/mol |
| Exact Mass | 784.30 |
| IUPAC Name | 4-[2-[2-[2-[2-[3-[2-[2-[2-[2-(4-sulfobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCOCCOCCOCCOCCOc1cc2ccccc2cc1OCCOCCOCCOCCOCCCCS(=O)(=O)O |
| InChI | InChI=1S/C34H56O16S2/c35-51(36,37)27-5-3-9-41-11-13-43-15-17-45-19-21-47-23-25-49-33-29-31-7-1-2-8-32(31)30-34(33)50-26-24-48-22-20-46-18-16-44-14-12-42-10-4-6-28-52(38,39)40/h1-2,7-8,29-30H,3-6,9-28H2,(H,35,36,37)(H,38,39,40) |
| InChIKey | KSDVQXTYKURJKX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 201.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|