C13H14O7S2 — CID 172802950
2-(3-sulfopropoxy)naphthalene-1-sulfonic acid (PubChem CID 172802950) has the molecular formula C13H14O7S2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-(3-sulfopropoxy)naphthalene-1-sulfonic acid.
| Compound Name | 2-(3-sulfopropoxy)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 172802950 |
| Molecular Formula | C13H14O7S2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-(3-sulfopropoxy)naphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCOc1ccc2ccccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C13H14O7S2/c14-21(15,16)9-3-8-20-12-7-6-10-4-1-2-5-11(10)13(12)22(17,18)19/h1-2,4-7H,3,8-9H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | RCRJQFGNKOUYGD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|