C12H12O5S — CID 139692859
2-(2-hydroxyethoxy)naphthalene-1-sulfonic acid (PubChem CID 139692859) has the molecular formula C12H12O5S and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)naphthalene-1-sulfonic acid.
| Compound Name | 2-(2-hydroxyethoxy)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 139692859 |
| Molecular Formula | C12H12O5S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-(2-hydroxyethoxy)naphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(OCCO)ccc2ccccc12 |
| InChI | InChI=1S/C12H12O5S/c13-7-8-17-11-6-5-9-3-1-2-4-10(9)12(11)18(14,15)16/h1-6,13H,7-8H2,(H,14,15,16) |
| InChIKey | DUEZZANFDABJDF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|