C21H22N2O6S2 — CID 138400262
azane;2-[(1-sulfonaphthalen-2-yl)methyl]naphthalene-1-sulfonic acid (PubChem CID 138400262) has the molecular formula C21H22N2O6S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is azane;2-[(1-sulfonaphthalen-2-yl)methyl]naphthalene-1-sulfonic acid.
| Compound Name | azane;2-[(1-sulfonaphthalen-2-yl)methyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 138400262 |
| Molecular Formula | C21H22N2O6S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | azane;2-[(1-sulfonaphthalen-2-yl)methyl]naphthalene-1-sulfonic acid |
| SMILES | N.N.O=S(=O)(O)c1c(Cc2ccc3ccccc3c2S(=O)(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C21H16O6S2.2H3N/c22-28(23,24)20-16(11-9-14-5-1-3-7-18(14)20)13-17-12-10-15-6-2-4-8-19(15)21(17)29(25,26)27;;/h1-12H,13H2,(H,22,23,24)(H,25,26,27);2*1H3 |
| InChIKey | IYAZIAWDRDGKKX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|