C10H12O5S — CID 14946404
3-(2-formylphenoxy)propane-1-sulfonic acid (PubChem CID 14946404) has the molecular formula C10H12O5S and a molecular weight of 244.27 g/mol. Its IUPAC name is 3-(2-formylphenoxy)propane-1-sulfonic acid.
| Compound Name | 3-(2-formylphenoxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 14946404 |
| Molecular Formula | C10H12O5S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3-(2-formylphenoxy)propane-1-sulfonic acid |
| SMILES | O=Cc1ccccc1OCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H12O5S/c11-8-9-4-1-2-5-10(9)15-6-3-7-16(12,13)14/h1-2,4-5,8H,3,6-7H2,(H,12,13,14) |
| InChIKey | QMHBZWAJRUOGJS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|