About 2-ethoxybenzaldehyde;hydrofluoride
2-ethoxybenzaldehyde;hydrofluoride (PubChem CID 157329385) has the molecular formula C9H11FO2
and a molecular weight of 170.18 g/mol. Its IUPAC name is 2-ethoxybenzaldehyde;hydrofluoride.
Molecular Properties
| Compound Name | 2-ethoxybenzaldehyde;hydrofluoride |
| PubChem CID | 157329385 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-ethoxybenzaldehyde;hydrofluoride |
| SMILES | CCOc1ccccc1C=O.F |
| InChI | InChI=1S/C9H10O2.FH/c1-2-11-9-6-4-3-5-8(9)7-10;/h3-7H,2H2,1H3;1H |
| InChIKey | KUIWRMMHLMAFSB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxybenzaldehyde;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybenzaldehyde;hydrofluoride?
The IUPAC name of 2-ethoxybenzaldehyde;hydrofluoride (CID 157329385) is 2-ethoxybenzaldehyde;hydrofluoride.
What is the SMILES notation for 2-ethoxybenzaldehyde;hydrofluoride?
The canonical SMILES for 2-ethoxybenzaldehyde;hydrofluoride is CCOc1ccccc1C=O.F.
What is the InChIKey of 2-ethoxybenzaldehyde;hydrofluoride?
The InChIKey is KUIWRMMHLMAFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.FH/c1-2-11-9-6-4-3-5-8(9)7-10;/h3-7H,2H2,1H3;1H.
What are the key properties of 2-ethoxybenzaldehyde;hydrofluoride?
2-ethoxybenzaldehyde;hydrofluoride has a molecular weight of 170.18 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybenzaldehyde;hydrofluoride is sourced from PubChem (CID 157329385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).