About ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde
ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde (PubChem CID 145109455) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde.
Molecular Properties
| Compound Name | ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde |
| PubChem CID | 145109455 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde |
| SMILES | C#CCOc1ccccc1C=O.CC.CCOC |
| InChI | InChI=1S/C10H8O2.C3H8O.C2H6/c1-2-7-12-10-6-4-3-5-9(10)8-11;1-3-4-2;1-2/h1,3-6,8H,7H2;3H2,1-2H3;1-2H3 |
| InChIKey | XRQXGSDQFFYNFX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde?
The IUPAC name of ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde (CID 145109455) is ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde.
What is the SMILES notation for ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde?
The canonical SMILES for ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde is C#CCOc1ccccc1C=O.CC.CCOC.
What is the InChIKey of ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde?
The InChIKey is XRQXGSDQFFYNFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.C3H8O.C2H6/c1-2-7-12-10-6-4-3-5-9(10)8-11;1-3-4-2;1-2/h1,3-6,8H,7H2;3H2,1-2H3;1-2H3.
What are the key properties of ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde?
ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde has a molecular weight of 250.34 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxyethane;2-prop-2-ynoxybenzaldehyde is sourced from PubChem (CID 145109455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).