About 2-ethynoxybenzaldehyde
2-ethynoxybenzaldehyde (PubChem CID 12559935) has the molecular formula C9H6O2
and a molecular weight of 146.14 g/mol. Its IUPAC name is 2-ethynoxybenzaldehyde.
Molecular Properties
| Compound Name | 2-ethynoxybenzaldehyde |
| PubChem CID | 12559935 |
| Molecular Formula | C9H6O2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 2-ethynoxybenzaldehyde |
| SMILES | C#COc1ccccc1C=O |
| InChI | InChI=1S/C9H6O2/c1-2-11-9-6-4-3-5-8(9)7-10/h1,3-7H |
| InChIKey | FVHMICYPBJJKRS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynoxybenzaldehyde?
The IUPAC name of 2-ethynoxybenzaldehyde (CID 12559935) is 2-ethynoxybenzaldehyde.
What is the SMILES notation for 2-ethynoxybenzaldehyde?
The canonical SMILES for 2-ethynoxybenzaldehyde is C#COc1ccccc1C=O.
What is the InChIKey of 2-ethynoxybenzaldehyde?
The InChIKey is FVHMICYPBJJKRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2/c1-2-11-9-6-4-3-5-8(9)7-10/h1,3-7H.
What are the key properties of 2-ethynoxybenzaldehyde?
2-ethynoxybenzaldehyde has a molecular weight of 146.14 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynoxybenzaldehyde is sourced from PubChem (CID 12559935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).