About (2-formylphenyl) nitrate;methanol
(2-formylphenyl) nitrate;methanol (PubChem CID 175529828) has the molecular formula C8H9NO5
and a molecular weight of 199.16 g/mol. Its IUPAC name is (2-formylphenyl) nitrate;methanol.
Molecular Properties
| Compound Name | (2-formylphenyl) nitrate;methanol |
| PubChem CID | 175529828 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | (2-formylphenyl) nitrate;methanol |
| SMILES | CO.O=Cc1ccccc1O[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO4.CH4O/c9-5-6-3-1-2-4-7(6)12-8(10)11;1-2/h1-5H;2H,1H3 |
| InChIKey | ZPYWMGFMFGTRJC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-formylphenyl) nitrate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formylphenyl) nitrate;methanol?
The IUPAC name of (2-formylphenyl) nitrate;methanol (CID 175529828) is (2-formylphenyl) nitrate;methanol.
What is the SMILES notation for (2-formylphenyl) nitrate;methanol?
The canonical SMILES for (2-formylphenyl) nitrate;methanol is CO.O=Cc1ccccc1O[N+](=O)[O-].
What is the InChIKey of (2-formylphenyl) nitrate;methanol?
The InChIKey is ZPYWMGFMFGTRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4.CH4O/c9-5-6-3-1-2-4-7(6)12-8(10)11;1-2/h1-5H;2H,1H3.
What are the key properties of (2-formylphenyl) nitrate;methanol?
(2-formylphenyl) nitrate;methanol has a molecular weight of 199.16 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formylphenyl) nitrate;methanol is sourced from PubChem (CID 175529828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).