About ethanol;2-nitrobenzaldehyde
ethanol;2-nitrobenzaldehyde (PubChem CID 175129011) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is ethanol;2-nitrobenzaldehyde.
Molecular Properties
| Compound Name | ethanol;2-nitrobenzaldehyde |
| PubChem CID | 175129011 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | ethanol;2-nitrobenzaldehyde |
| SMILES | CCO.O=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO3.C2H6O/c9-5-6-3-1-2-4-7(6)8(10)11;1-2-3/h1-5H;3H,2H2,1H3 |
| InChIKey | HPITVVFHSDKLSK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-nitrobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-nitrobenzaldehyde?
The IUPAC name of ethanol;2-nitrobenzaldehyde (CID 175129011) is ethanol;2-nitrobenzaldehyde.
What is the SMILES notation for ethanol;2-nitrobenzaldehyde?
The canonical SMILES for ethanol;2-nitrobenzaldehyde is CCO.O=Cc1ccccc1[N+](=O)[O-].
What is the InChIKey of ethanol;2-nitrobenzaldehyde?
The InChIKey is HPITVVFHSDKLSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3.C2H6O/c9-5-6-3-1-2-4-7(6)8(10)11;1-2-3/h1-5H;3H,2H2,1H3.
What are the key properties of ethanol;2-nitrobenzaldehyde?
ethanol;2-nitrobenzaldehyde has a molecular weight of 197.19 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-nitrobenzaldehyde is sourced from PubChem (CID 175129011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).