About methanethione;methyl propanoate;2-nitrobenzaldehyde
methanethione;methyl propanoate;2-nitrobenzaldehyde (PubChem CID 175428149) has the molecular formula C12H15NO5S
and a molecular weight of 285.32 g/mol. Its IUPAC name is methanethione;methyl propanoate;2-nitrobenzaldehyde.
Molecular Properties
| Compound Name | methanethione;methyl propanoate;2-nitrobenzaldehyde |
| PubChem CID | 175428149 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | methanethione;methyl propanoate;2-nitrobenzaldehyde |
| SMILES | C=S.CCC(=O)OC.O=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO3.C4H8O2.CH2S/c9-5-6-3-1-2-4-7(6)8(10)11;1-3-4(5)6-2;1-2/h1-5H;3H2,1-2H3;1H2 |
| InChIKey | KNHGWXQLIJYRFY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methanethione;methyl propanoate;2-nitrobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethione;methyl propanoate;2-nitrobenzaldehyde?
The IUPAC name of methanethione;methyl propanoate;2-nitrobenzaldehyde (CID 175428149) is methanethione;methyl propanoate;2-nitrobenzaldehyde.
What is the SMILES notation for methanethione;methyl propanoate;2-nitrobenzaldehyde?
The canonical SMILES for methanethione;methyl propanoate;2-nitrobenzaldehyde is C=S.CCC(=O)OC.O=Cc1ccccc1[N+](=O)[O-].
What is the InChIKey of methanethione;methyl propanoate;2-nitrobenzaldehyde?
The InChIKey is KNHGWXQLIJYRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3.C4H8O2.CH2S/c9-5-6-3-1-2-4-7(6)8(10)11;1-3-4(5)6-2;1-2/h1-5H;3H2,1-2H3;1H2.
What are the key properties of methanethione;methyl propanoate;2-nitrobenzaldehyde?
methanethione;methyl propanoate;2-nitrobenzaldehyde has a molecular weight of 285.32 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanethione;methyl propanoate;2-nitrobenzaldehyde is sourced from PubChem (CID 175428149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).