About formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde
formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde (PubChem CID 174961995) has the molecular formula C15H12N2O7
and a molecular weight of 332.27 g/mol. Its IUPAC name is formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde.
Molecular Properties
| Compound Name | formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde |
| PubChem CID | 174961995 |
| Molecular Formula | C15H12N2O7 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde |
| SMILES | C=O.O=Cc1cccc([N+](=O)[O-])c1.O=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/2C7H5NO3.CH2O/c9-5-6-2-1-3-7(4-6)8(10)11;9-5-6-3-1-2-4-7(6)8(10)11;1-2/h2*1-5H;1H2 |
| InChIKey | VWWNTTKDSHADIS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 137.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde?
The IUPAC name of formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde (CID 174961995) is formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde.
What is the SMILES notation for formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde?
The canonical SMILES for formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde is C=O.O=Cc1cccc([N+](=O)[O-])c1.O=Cc1ccccc1[N+](=O)[O-].
What is the InChIKey of formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde?
The InChIKey is VWWNTTKDSHADIS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5NO3.CH2O/c9-5-6-2-1-3-7(4-6)8(10)11;9-5-6-3-1-2-4-7(6)8(10)11;1-2/h2*1-5H;1H2.
What are the key properties of formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde?
formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde has a molecular weight of 332.27 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-nitrobenzaldehyde;3-nitrobenzaldehyde is sourced from PubChem (CID 174961995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).