About benzoic acid;3-nitrobenzaldehyde
benzoic acid;3-nitrobenzaldehyde (PubChem CID 174639246) has the molecular formula C14H11NO5
and a molecular weight of 273.24 g/mol. Its IUPAC name is benzoic acid;3-nitrobenzaldehyde.
Molecular Properties
| Compound Name | benzoic acid;3-nitrobenzaldehyde |
| PubChem CID | 174639246 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | benzoic acid;3-nitrobenzaldehyde |
| SMILES | O=C(O)c1ccccc1.O=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5NO3.C7H6O2/c9-5-6-2-1-3-7(4-6)8(10)11;8-7(9)6-4-2-1-3-5-6/h1-5H;1-5H,(H,8,9) |
| InChIKey | SFXYOHJOMZPOKO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;3-nitrobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;3-nitrobenzaldehyde?
The IUPAC name of benzoic acid;3-nitrobenzaldehyde (CID 174639246) is benzoic acid;3-nitrobenzaldehyde.
What is the SMILES notation for benzoic acid;3-nitrobenzaldehyde?
The canonical SMILES for benzoic acid;3-nitrobenzaldehyde is O=C(O)c1ccccc1.O=Cc1cccc([N+](=O)[O-])c1.
What is the InChIKey of benzoic acid;3-nitrobenzaldehyde?
The InChIKey is SFXYOHJOMZPOKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3.C7H6O2/c9-5-6-2-1-3-7(4-6)8(10)11;8-7(9)6-4-2-1-3-5-6/h1-5H;1-5H,(H,8,9).
What are the key properties of benzoic acid;3-nitrobenzaldehyde?
benzoic acid;3-nitrobenzaldehyde has a molecular weight of 273.24 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;3-nitrobenzaldehyde is sourced from PubChem (CID 174639246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).