About 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide
3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide (PubChem CID 131882350) has the molecular formula C15H13Br2NO3
and a molecular weight of 415.08 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide.
Molecular Properties
| Compound Name | 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide |
| PubChem CID | 131882350 |
| Molecular Formula | C15H13Br2NO3 |
| Molecular Weight | 415.08 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide |
| SMILES | Br.Br.O=C(C=Cc1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C15H11NO3.2BrH/c17-15(13-6-2-1-3-7-13)10-9-12-5-4-8-14(11-12)16(18)19;;/h1-11H;2*1H |
| InChIKey | LRSZHYQBUYECHL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.08 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide?
The IUPAC name of 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide (CID 131882350) is 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide.
What is the SMILES notation for 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide?
The canonical SMILES for 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide is Br.Br.O=C(C=Cc1cccc([N+](=O)[O-])c1)c1ccccc1.
What is the InChIKey of 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide?
The InChIKey is LRSZHYQBUYECHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3.2BrH/c17-15(13-6-2-1-3-7-13)10-9-12-5-4-8-14(11-12)16(18)19;;/h1-11H;2*1H.
What are the key properties of 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide?
3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide has a molecular weight of 415.08 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-nitrophenyl)-1-phenylprop-2-en-1-one;dihydrobromide is sourced from PubChem (CID 131882350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).