C15H9F2NO3 — CID 7514637
(E)-1-(3,4-difluorophenyl)-3-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 7514637) has the molecular formula C15H9F2NO3 and a molecular weight of 289.24 g/mol. Its IUPAC name is (E)-1-(3,4-difluorophenyl)-3-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-difluorophenyl)-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7514637 |
| Molecular Formula | C15H9F2NO3 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (E)-1-(3,4-difluorophenyl)-3-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H9F2NO3/c16-13-6-5-11(9-14(13)17)15(19)7-4-10-2-1-3-12(8-10)18(20)21/h1-9H/b7-4+ |
| InChIKey | ZEXDHSBPHNQVCF-QPJJXVBHSA-N |
| XLogP | 3.77 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|