C18H15NO3 — CID 92900023
(1E,4Z)-2-methyl-5-(3-nitrophenyl)-1-phenylpenta-1,4-dien-3-one (PubChem CID 92900023) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is (1E,4Z)-2-methyl-5-(3-nitrophenyl)-1-phenylpenta-1,4-dien-3-one.
| Compound Name | (1E,4Z)-2-methyl-5-(3-nitrophenyl)-1-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 92900023 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (1E,4Z)-2-methyl-5-(3-nitrophenyl)-1-phenylpenta-1,4-dien-3-one |
| SMILES | C/C(=C\c1ccccc1)C(=O)/C=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15NO3/c1-14(12-15-6-3-2-4-7-15)18(20)11-10-16-8-5-9-17(13-16)19(21)22/h2-13H,1H3/b11-10-,14-12+ |
| InChIKey | CQRJGTMFTKHFQQ-HSINTONASA-N |
| XLogP | 4.28 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|