C15H13NO5S2 — CID 71676144
(E)-2-(1,3-dithian-2-ylidene)-5-(3-nitrophenyl)-3-oxopent-4-enoic acid (PubChem CID 71676144) has the molecular formula C15H13NO5S2 and a molecular weight of 351.40 g/mol. Its IUPAC name is (E)-2-(1,3-dithian-2-ylidene)-5-(3-nitrophenyl)-3-oxopent-4-enoic acid.
| Compound Name | (E)-2-(1,3-dithian-2-ylidene)-5-(3-nitrophenyl)-3-oxopent-4-enoic acid |
|---|---|
| PubChem CID | 71676144 |
| Molecular Formula | C15H13NO5S2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | (E)-2-(1,3-dithian-2-ylidene)-5-(3-nitrophenyl)-3-oxopent-4-enoic acid |
| SMILES | O=C(O)C(C(=O)/C=C/c1cccc([N+](=O)[O-])c1)=C1SCCCS1 |
| InChI | InChI=1S/C15H13NO5S2/c17-12(13(14(18)19)15-22-7-2-8-23-15)6-5-10-3-1-4-11(9-10)16(20)21/h1,3-6,9H,2,7-8H2,(H,18,19)/b6-5+ |
| InChIKey | QPOSJWPCUXXFFW-AATRIKPKSA-N |
| XLogP | 3.34 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|