C14H13NO3S2 — CID 838678
(E)-1-(1,3-dithian-2-ylidene)-4-(3-nitrophenyl)but-3-en-2-one (PubChem CID 838678) has the molecular formula C14H13NO3S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is (E)-1-(1,3-dithian-2-ylidene)-4-(3-nitrophenyl)but-3-en-2-one.
| Compound Name | (E)-1-(1,3-dithian-2-ylidene)-4-(3-nitrophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 838678 |
| Molecular Formula | C14H13NO3S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (E)-1-(1,3-dithian-2-ylidene)-4-(3-nitrophenyl)but-3-en-2-one |
| SMILES | O=C(C=C1SCCCS1)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13NO3S2/c16-13(10-14-19-7-2-8-20-14)6-5-11-3-1-4-12(9-11)15(17)18/h1,3-6,9-10H,2,7-8H2/b6-5+ |
| InChIKey | MXTGUPBHZBSSHF-AATRIKPKSA-N |
| XLogP | 3.89 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|