C15H15NO5S2 — CID 163168107
3-[4-carboxy-4-(1,3-dithian-2-ylidene)-3-oxobut-1-enyl]-N-hydroxybenzeneamine oxide (PubChem CID 163168107) has the molecular formula C15H15NO5S2 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-[4-carboxy-4-(1,3-dithian-2-ylidene)-3-oxobut-1-enyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[4-carboxy-4-(1,3-dithian-2-ylidene)-3-oxobut-1-enyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163168107 |
| Molecular Formula | C15H15NO5S2 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 3-[4-carboxy-4-(1,3-dithian-2-ylidene)-3-oxobut-1-enyl]-N-hydroxybenzeneamine oxide |
| SMILES | O=C(O)C(C(=O)C=Cc1cccc([NH+]([O-])O)c1)=C1SCCCS1 |
| InChI | InChI=1S/C15H15NO5S2/c17-12(13(14(18)19)15-22-7-2-8-23-15)6-5-10-3-1-4-11(9-10)16(20)21/h1,3-6,9,16,20H,2,7-8H2,(H,18,19) |
| InChIKey | UGHHGERGTLPHAK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|