C16H15ClO2S2 — CID 135002641
(E)-6-(4-chlorophenyl)-3-(1,3-dithian-2-ylidene)hex-5-ene-2,4-dione (PubChem CID 135002641) has the molecular formula C16H15ClO2S2 and a molecular weight of 338.88 g/mol. Its IUPAC name is (E)-6-(4-chlorophenyl)-3-(1,3-dithian-2-ylidene)hex-5-ene-2,4-dione.
| Compound Name | (E)-6-(4-chlorophenyl)-3-(1,3-dithian-2-ylidene)hex-5-ene-2,4-dione |
|---|---|
| PubChem CID | 135002641 |
| Molecular Formula | C16H15ClO2S2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | (E)-6-(4-chlorophenyl)-3-(1,3-dithian-2-ylidene)hex-5-ene-2,4-dione |
| SMILES | CC(=O)C(C(=O)/C=C/c1ccc(Cl)cc1)=C1SCCCS1 |
| InChI | InChI=1S/C16H15ClO2S2/c1-11(18)15(16-20-9-2-10-21-16)14(19)8-5-12-3-6-13(17)7-4-12/h3-8H,2,9-10H2,1H3/b8-5+ |
| InChIKey | OSYYUCAWLIVIOF-VMPITWQZSA-N |
| XLogP | 4.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|