C18H18O2S2 — CID 11983786
(5E,7E)-3-(1,3-dithian-2-ylidene)-8-phenylocta-5,7-diene-2,4-dione (PubChem CID 11983786) has the molecular formula C18H18O2S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (5E,7E)-3-(1,3-dithian-2-ylidene)-8-phenylocta-5,7-diene-2,4-dione.
| Compound Name | (5E,7E)-3-(1,3-dithian-2-ylidene)-8-phenylocta-5,7-diene-2,4-dione |
|---|---|
| PubChem CID | 11983786 |
| Molecular Formula | C18H18O2S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (5E,7E)-3-(1,3-dithian-2-ylidene)-8-phenylocta-5,7-diene-2,4-dione |
| SMILES | CC(=O)C(C(=O)/C=C/C=C/c1ccccc1)=C1SCCCS1 |
| InChI | InChI=1S/C18H18O2S2/c1-14(19)17(18-21-12-7-13-22-18)16(20)11-6-5-10-15-8-3-2-4-9-15/h2-6,8-11H,7,12-13H2,1H3/b10-5+,11-6+ |
| InChIKey | QIPRNQMQRWHXKM-YOYBCKCWSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|