C11H11ClO2 — CID 173012318
5-phenylpenta-2,4-dienoic acid;hydrochloride (PubChem CID 173012318) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is 5-phenylpenta-2,4-dienoic acid;hydrochloride.
| Compound Name | 5-phenylpenta-2,4-dienoic acid;hydrochloride |
|---|---|
| PubChem CID | 173012318 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 5-phenylpenta-2,4-dienoic acid;hydrochloride |
| SMILES | Cl.O=C(O)C=CC=Cc1ccccc1 |
| InChI | InChI=1S/C11H10O2.ClH/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;/h1-9H,(H,12,13);1H |
| InChIKey | QUKPTJTVKZAXMA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|