C20H17ClO4 — CID 173256953
3-(4-chlorophenyl)prop-2-enoic acid;5-phenylpenta-2,4-dienoic acid (PubChem CID 173256953) has the molecular formula C20H17ClO4 and a molecular weight of 356.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)prop-2-enoic acid;5-phenylpenta-2,4-dienoic acid.
| Compound Name | 3-(4-chlorophenyl)prop-2-enoic acid;5-phenylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 173256953 |
| Molecular Formula | C20H17ClO4 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 3-(4-chlorophenyl)prop-2-enoic acid;5-phenylpenta-2,4-dienoic acid |
| SMILES | O=C(O)C=CC=Cc1ccccc1.O=C(O)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10O2.C9H7ClO2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;10-8-4-1-7(2-5-8)3-6-9(11)12/h1-9H,(H,12,13);1-6H,(H,11,12) |
| InChIKey | CMOVOBIZZQJUCL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|