C13H13NO2 — CID 71362968
N-hydroxy-7-phenylhepta-2,4,6-trienamide (PubChem CID 71362968) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is N-hydroxy-7-phenylhepta-2,4,6-trienamide.
| Compound Name | N-hydroxy-7-phenylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 71362968 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | N-hydroxy-7-phenylhepta-2,4,6-trienamide |
| SMILES | O=C(C=CC=CC=Cc1ccccc1)NO |
| InChI | InChI=1S/C13H13NO2/c15-13(14-16)11-7-2-1-4-8-12-9-5-3-6-10-12/h1-11,16H,(H,14,15) |
| InChIKey | DBBYYRWVNDQECM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|