C13H16N2O2 — CID 125484977
(2E,4E)-N'-methoxy-N'-methyl-5-phenylpenta-2,4-dienehydrazide (PubChem CID 125484977) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2E,4E)-N'-methoxy-N'-methyl-5-phenylpenta-2,4-dienehydrazide.
| Compound Name | (2E,4E)-N'-methoxy-N'-methyl-5-phenylpenta-2,4-dienehydrazide |
|---|---|
| PubChem CID | 125484977 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (2E,4E)-N'-methoxy-N'-methyl-5-phenylpenta-2,4-dienehydrazide |
| SMILES | CON(C)NC(=O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H16N2O2/c1-15(17-2)14-13(16)11-7-6-10-12-8-4-3-5-9-12/h3-11H,1-2H3,(H,14,16)/b10-6+,11-7+ |
| InChIKey | QHCZBPRAVZKXNH-JMQWPVDRSA-N |
| XLogP | 1.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|