C16H16O2S — CID 90725185
O-(2-oxo-8-phenylocta-3,5,7-trienyl) ethanethioate (PubChem CID 90725185) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is O-(2-oxo-8-phenylocta-3,5,7-trienyl) ethanethioate.
| Compound Name | O-(2-oxo-8-phenylocta-3,5,7-trienyl) ethanethioate |
|---|---|
| PubChem CID | 90725185 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | O-(2-oxo-8-phenylocta-3,5,7-trienyl) ethanethioate |
| SMILES | CC(=S)OCC(=O)C=CC=CC=Cc1ccccc1 |
| InChI | InChI=1S/C16H16O2S/c1-14(19)18-13-16(17)12-8-3-2-5-9-15-10-6-4-7-11-15/h2-12H,13H2,1H3 |
| InChIKey | OIKKCHPUDAWXSP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|