C14H14O — CID 100937640
(5E,7E)-8-phenylocta-1,5,7-trien-4-one (PubChem CID 100937640) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is (5E,7E)-8-phenylocta-1,5,7-trien-4-one.
| Compound Name | (5E,7E)-8-phenylocta-1,5,7-trien-4-one |
|---|---|
| PubChem CID | 100937640 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (5E,7E)-8-phenylocta-1,5,7-trien-4-one |
| SMILES | C=CCC(=O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H14O/c1-2-8-14(15)12-7-6-11-13-9-4-3-5-10-13/h2-7,9-12H,1,8H2/b11-6+,12-7+ |
| InChIKey | OJIWBJFJUKONBY-GNXRPPCSSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|