C15H16 — CID 173155039
5-methylideneocta-1,3,7-trienylbenzene (PubChem CID 173155039) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 5-methylideneocta-1,3,7-trienylbenzene.
| Compound Name | 5-methylideneocta-1,3,7-trienylbenzene |
|---|---|
| PubChem CID | 173155039 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 5-methylideneocta-1,3,7-trienylbenzene |
| SMILES | C=CCC(=C)C=CC=Cc1ccccc1 |
| InChI | InChI=1S/C15H16/c1-3-9-14(2)10-7-8-13-15-11-5-4-6-12-15/h3-8,10-13H,1-2,9H2 |
| InChIKey | HCGRVRQJVBMJRX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|