C15H14O — CID 142085099
(5E,7E)-3-methylidene-8-phenylocta-1,5,7-trien-4-one (PubChem CID 142085099) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is (5E,7E)-3-methylidene-8-phenylocta-1,5,7-trien-4-one.
| Compound Name | (5E,7E)-3-methylidene-8-phenylocta-1,5,7-trien-4-one |
|---|---|
| PubChem CID | 142085099 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (5E,7E)-3-methylidene-8-phenylocta-1,5,7-trien-4-one |
| SMILES | C=CC(=C)C(=O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H14O/c1-3-13(2)15(16)12-8-7-11-14-9-5-4-6-10-14/h3-12H,1-2H2/b11-7+,12-8+ |
| InChIKey | YAXWFRKHAQVBPI-MKICQXMISA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|