C15H15NaO2 — CID 175798582
sodium;buta-1,3-diene;5-phenylpenta-2,4-dienoate (PubChem CID 175798582) has the molecular formula C15H15NaO2 and a molecular weight of 250.27 g/mol. Its IUPAC name is sodium;buta-1,3-diene;5-phenylpenta-2,4-dienoate.
| Compound Name | sodium;buta-1,3-diene;5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 175798582 |
| Molecular Formula | C15H15NaO2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | sodium;buta-1,3-diene;5-phenylpenta-2,4-dienoate |
| SMILES | C=CC=C.O=C([O-])C=CC=Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C11H10O2.C4H6.Na/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;1-3-4-2;/h1-9H,(H,12,13);3-4H,1-2H2;/q;;+1/p-1 |
| InChIKey | OVOYVOLUNKIJAD-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|