C13H14O3 — CID 118450762
carbonic acid;hexa-1,3,5-trienylbenzene (PubChem CID 118450762) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is carbonic acid;hexa-1,3,5-trienylbenzene.
| Compound Name | carbonic acid;hexa-1,3,5-trienylbenzene |
|---|---|
| PubChem CID | 118450762 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | carbonic acid;hexa-1,3,5-trienylbenzene |
| SMILES | C=CC=CC=Cc1ccccc1.O=C(O)O |
| InChI | InChI=1S/C12H12.CH2O3/c1-2-3-4-6-9-12-10-7-5-8-11-12;2-1(3)4/h2-11H,1H2;(H2,2,3,4) |
| InChIKey | VRHYLORXTFQMOO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|