C14H16O2 — CID 160671566
buta-1,3-dienylbenzene;2-methylprop-2-enoic acid (PubChem CID 160671566) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is buta-1,3-dienylbenzene;2-methylprop-2-enoic acid.
| Compound Name | buta-1,3-dienylbenzene;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 160671566 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | buta-1,3-dienylbenzene;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC=Cc1ccccc1 |
| InChI | InChI=1S/C10H10.C4H6O2/c1-2-3-7-10-8-5-4-6-9-10;1-3(2)4(5)6/h2-9H,1H2;1H2,2H3,(H,5,6) |
| InChIKey | RMZLQVAKWDSGRU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|