C13H14 — CID 91462771
3-methylidenehexa-1,5-dienylbenzene (PubChem CID 91462771) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3-methylidenehexa-1,5-dienylbenzene.
| Compound Name | 3-methylidenehexa-1,5-dienylbenzene |
|---|---|
| PubChem CID | 91462771 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-methylidenehexa-1,5-dienylbenzene |
| SMILES | C=CCC(=C)C=Cc1ccccc1 |
| InChI | InChI=1S/C13H14/c1-3-7-12(2)10-11-13-8-5-4-6-9-13/h3-6,8-11H,1-2,7H2 |
| InChIKey | DCLQGAFGEXJADK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|