C19H22O2 — CID 101156784
ethyl (2Z,4E,8E)-3-methyl-7-methylidene-9-phenylnona-2,4,8-trienoate (PubChem CID 101156784) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is ethyl (2Z,4E,8E)-3-methyl-7-methylidene-9-phenylnona-2,4,8-trienoate.
| Compound Name | ethyl (2Z,4E,8E)-3-methyl-7-methylidene-9-phenylnona-2,4,8-trienoate |
|---|---|
| PubChem CID | 101156784 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | ethyl (2Z,4E,8E)-3-methyl-7-methylidene-9-phenylnona-2,4,8-trienoate |
| SMILES | C=C(/C=C/c1ccccc1)C/C=C/C(C)=C\C(=O)OCC |
| InChI | InChI=1S/C19H22O2/c1-4-21-19(20)15-17(3)10-8-9-16(2)13-14-18-11-6-5-7-12-18/h5-8,10-15H,2,4,9H2,1,3H3/b10-8+,14-13+,17-15- |
| InChIKey | UYYIWOMAVUFJRC-INGHAAELSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|