About ethyl acetate;stilbene
ethyl acetate;stilbene (PubChem CID 159556390) has the molecular formula C18H20O2
and a molecular weight of 268.36 g/mol. Its IUPAC name is ethyl acetate;stilbene.
Molecular Properties
| Compound Name | ethyl acetate;stilbene |
| PubChem CID | 159556390 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | ethyl acetate;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.CCOC(C)=O |
| InChI | InChI=1S/C14H12.C4H8O2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-3-6-4(2)5/h1-12H;3H2,1-2H3 |
| InChIKey | MGASNHOIHZEZTP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;stilbene?
The IUPAC name of ethyl acetate;stilbene (CID 159556390) is ethyl acetate;stilbene.
What is the SMILES notation for ethyl acetate;stilbene?
The canonical SMILES for ethyl acetate;stilbene is C(=Cc1ccccc1)c1ccccc1.CCOC(C)=O.
What is the InChIKey of ethyl acetate;stilbene?
The InChIKey is MGASNHOIHZEZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C4H8O2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-3-6-4(2)5/h1-12H;3H2,1-2H3.
What are the key properties of ethyl acetate;stilbene?
ethyl acetate;stilbene has a molecular weight of 268.36 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;stilbene is sourced from PubChem (CID 159556390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).