About acetic acid;stilbene
acetic acid;stilbene (PubChem CID 172803728) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is acetic acid;stilbene.
Molecular Properties
| Compound Name | acetic acid;stilbene |
| PubChem CID | 172803728 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | acetic acid;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.CC(=O)O.CC(=O)O |
| InChI | InChI=1S/C14H12.2C2H4O2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-2(3)4/h1-12H;2*1H3,(H,3,4) |
| InChIKey | RFHSXFKQYFHGGI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;stilbene?
The IUPAC name of acetic acid;stilbene (CID 172803728) is acetic acid;stilbene.
What is the SMILES notation for acetic acid;stilbene?
The canonical SMILES for acetic acid;stilbene is C(=Cc1ccccc1)c1ccccc1.CC(=O)O.CC(=O)O.
What is the InChIKey of acetic acid;stilbene?
The InChIKey is RFHSXFKQYFHGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.2C2H4O2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-2(3)4/h1-12H;2*1H3,(H,3,4).
What are the key properties of acetic acid;stilbene?
acetic acid;stilbene has a molecular weight of 300.35 g/mol, XLogP of 4.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;stilbene is sourced from PubChem (CID 172803728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).