About ethyl carbamate;stilbene
ethyl carbamate;stilbene (PubChem CID 175156091) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl carbamate;stilbene.
Molecular Properties
| Compound Name | ethyl carbamate;stilbene |
| PubChem CID | 175156091 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethyl carbamate;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.CCOC(N)=O |
| InChI | InChI=1S/C14H12.C3H7NO2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-6-3(4)5/h1-12H;2H2,1H3,(H2,4,5) |
| InChIKey | QXHBDULMOSEQQG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethyl carbamate;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl carbamate;stilbene?
The IUPAC name of ethyl carbamate;stilbene (CID 175156091) is ethyl carbamate;stilbene.
What is the SMILES notation for ethyl carbamate;stilbene?
The canonical SMILES for ethyl carbamate;stilbene is C(=Cc1ccccc1)c1ccccc1.CCOC(N)=O.
What is the InChIKey of ethyl carbamate;stilbene?
The InChIKey is QXHBDULMOSEQQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C3H7NO2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-6-3(4)5/h1-12H;2H2,1H3,(H2,4,5).
What are the key properties of ethyl carbamate;stilbene?
ethyl carbamate;stilbene has a molecular weight of 269.34 g/mol, XLogP of 3.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbamate;stilbene is sourced from PubChem (CID 175156091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).